C10H8F13N — CID 19761937
2-(difluoromethylidene)-1,1,3,3,4,5,5,5-octafluoro-N-propyl-4-(trifluoromethyl)pentan-1-amine (PubChem CID 19761937) has the molecular formula C10H8F13N and a molecular weight of 389.16 g/mol. Its IUPAC name is 2-(difluoromethylidene)-1,1,3,3,4,5,5,5-octafluoro-N-propyl-4-(trifluoromethyl)pentan-1-amine.
| Compound Name | 2-(difluoromethylidene)-1,1,3,3,4,5,5,5-octafluoro-N-propyl-4-(trifluoromethyl)pentan-1-amine |
|---|---|
| PubChem CID | 19761937 |
| Molecular Formula | C10H8F13N |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(difluoromethylidene)-1,1,3,3,4,5,5,5-octafluoro-N-propyl-4-(trifluoromethyl)pentan-1-amine |
| SMILES | CCCNC(F)(F)C(=C(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F13N/c1-2-3-24-7(15,16)4(5(11)12)6(13,14)8(17,9(18,19)20)10(21,22)23/h24H,2-3H2,1H3 |
| InChIKey | IHMOBYAMFRKJHX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|