C12H11F13O — CID 19761938
1,1,1,4,5,5,5-heptafluoro-3-(3-methylbutoxy)-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 19761938) has the molecular formula C12H11F13O and a molecular weight of 418.19 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-(3-methylbutoxy)-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-(3-methylbutoxy)-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 19761938 |
| Molecular Formula | C12H11F13O |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-(3-methylbutoxy)-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)CCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13O/c1-5(2)3-4-26-7(6(9(14,15)16)10(17,18)19)8(13,11(20,21)22)12(23,24)25/h5H,3-4H2,1-2H3 |
| InChIKey | PACRBBPBKMIQOG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|