C11H15F9O — CID 19761939
1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-(2-methylpropoxy)pentane (PubChem CID 19761939) has the molecular formula C11H15F9O and a molecular weight of 334.22 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-(2-methylpropoxy)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-(2-methylpropoxy)pentane |
|---|---|
| PubChem CID | 19761939 |
| Molecular Formula | C11H15F9O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-(2-methylpropoxy)pentane |
| SMILES | CC(C)COC(F)(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O/c1-6(2)5-21-9(14,7(3,12)10(15,16)17)8(4,13)11(18,19)20/h6H,5H2,1-4H3 |
| InChIKey | CSAXZCISNWOMJN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |