C11H12F10O2 — CID 19761967
(1,1,1,3,3,4,4,5,5,5-decafluoro-2-methylpentan-2-yl) 3-methylbutanoate (PubChem CID 19761967) has the molecular formula C11H12F10O2 and a molecular weight of 366.20 g/mol. Its IUPAC name is (1,1,1,3,3,4,4,5,5,5-decafluoro-2-methylpentan-2-yl) 3-methylbutanoate.
| Compound Name | (1,1,1,3,3,4,4,5,5,5-decafluoro-2-methylpentan-2-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 19761967 |
| Molecular Formula | C11H12F10O2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (1,1,1,3,3,4,4,5,5,5-decafluoro-2-methylpentan-2-yl) 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(C)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F10O2/c1-5(2)4-6(22)23-7(3,10(16,17)18)8(12,13)9(14,15)11(19,20)21/h5H,4H2,1-3H3 |
| InChIKey | JBALKOOMBQEDNJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|