C10H8F14O2 — CID 19761973
5-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2,3,3,4,4-octafluoropentane (PubChem CID 19761973) has the molecular formula C10H8F14O2 and a molecular weight of 426.14 g/mol. Its IUPAC name is 5-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2,3,3,4,4-octafluoropentane.
| Compound Name | 5-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2,3,3,4,4-octafluoropentane |
|---|---|
| PubChem CID | 19761973 |
| Molecular Formula | C10H8F14O2 |
| Molecular Weight | 426.14 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 5-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2,3,3,4,4-octafluoropentane |
| SMILES | CCOC(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F14O2/c1-2-25-8(9(19,20)21,10(22,23)24)26-3-5(13,14)7(17,18)6(15,16)4(11)12/h4H,2-3H2,1H3 |
| InChIKey | BSWNUHAUHDIVRW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|