C10H9F11O — CID 19761976
3-butoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene (PubChem CID 19761976) has the molecular formula C10H9F11O and a molecular weight of 354.16 g/mol. Its IUPAC name is 3-butoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 3-butoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 19761976 |
| Molecular Formula | C10H9F11O |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-butoxy-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
| SMILES | CCCCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11O/c1-2-3-4-22-6(7(11,12)10(19,20)21)5(8(13,14)15)9(16,17)18/h2-4H2,1H3 |
| InChIKey | RENVPNURTYFALX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|