C11H11F11O — CID 19761980
1,1,1,4,4,5,5,5-octafluoro-3-(3-methylbutoxy)-2-(trifluoromethyl)pent-2-ene (PubChem CID 19761980) has the molecular formula C11H11F11O and a molecular weight of 368.19 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-(3-methylbutoxy)-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-(3-methylbutoxy)-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 19761980 |
| Molecular Formula | C11H11F11O |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-(3-methylbutoxy)-2-(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)CCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F11O/c1-5(2)3-4-23-7(8(12,13)11(20,21)22)6(9(14,15)16)10(17,18)19/h5H,3-4H2,1-2H3 |
| InChIKey | CITXPNQRRCKZDW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|