C10H10F11N — CID 19761981
N,N-diethyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-amine (PubChem CID 19761981) has the molecular formula C10H10F11N and a molecular weight of 353.18 g/mol. Its IUPAC name is N,N-diethyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-amine.
| Compound Name | N,N-diethyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 19761981 |
| Molecular Formula | C10H10F11N |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N,N-diethyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-amine |
| SMILES | CCN(CC)C(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F11N/c1-3-22(4-2)6(7(11,12)10(19,20)21)5(8(13,14)15)9(16,17)18/h3-4H2,1-2H3 |
| InChIKey | VPKQIMZQRJYDFT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|