C34H61N3O6 — CID 19762208
tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,3-tricarboxylate (PubChem CID 19762208) has the molecular formula C34H61N3O6 and a molecular weight of 607.88 g/mol. Its IUPAC name is tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,3-tricarboxylate.
| Compound Name | tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 19762208 |
| Molecular Formula | C34H61N3O6 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 607.46 |
| IUPAC Name | tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,3-tricarboxylate |
| SMILES | CC(CC(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C34H61N3O6/c1-21(26(38)41-22-15-29(2,3)35-30(4,5)16-22)14-25(27(39)42-23-17-31(6,7)36-32(8,9)18-23)28(40)43-24-19-33(10,11)37-34(12,13)20-24/h21-25,35-37H,14-20H2,1-13H3 |
| InChIKey | YIUKELPIVWJPMZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|