About triethyl(furan-2-yl)silane;urea
triethyl(furan-2-yl)silane;urea (PubChem CID 19762333) has the molecular formula C11H22N2O2Si
and a molecular weight of 242.40 g/mol. Its IUPAC name is triethyl(furan-2-yl)silane;urea.
Molecular Properties
| Compound Name | triethyl(furan-2-yl)silane;urea |
| PubChem CID | 19762333 |
| Molecular Formula | C11H22N2O2Si |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | triethyl(furan-2-yl)silane;urea |
| SMILES | CC[Si](CC)(CC)c1ccco1.NC(N)=O |
| InChI | InChI=1S/C10H18OSi.CH4N2O/c1-4-12(5-2,6-3)10-8-7-9-11-10;2-1(3)4/h7-9H,4-6H2,1-3H3;(H4,2,3,4) |
| InChIKey | NNGZHJPDQWGUEB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl(furan-2-yl)silane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(furan-2-yl)silane;urea?
The IUPAC name of triethyl(furan-2-yl)silane;urea (CID 19762333) is triethyl(furan-2-yl)silane;urea.
What is the SMILES notation for triethyl(furan-2-yl)silane;urea?
The canonical SMILES for triethyl(furan-2-yl)silane;urea is CC[Si](CC)(CC)c1ccco1.NC(N)=O.
What is the InChIKey of triethyl(furan-2-yl)silane;urea?
The InChIKey is NNGZHJPDQWGUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OSi.CH4N2O/c1-4-12(5-2,6-3)10-8-7-9-11-10;2-1(3)4/h7-9H,4-6H2,1-3H3;(H4,2,3,4).
What are the key properties of triethyl(furan-2-yl)silane;urea?
triethyl(furan-2-yl)silane;urea has a molecular weight of 242.40 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(furan-2-yl)silane;urea is sourced from PubChem (CID 19762333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).