C13H13F5N2O2 — CID 19762454
N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)piperidine-1-carboxamide (PubChem CID 19762454) has the molecular formula C13H13F5N2O2 and a molecular weight of 324.25 g/mol. Its IUPAC name is N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)piperidine-1-carboxamide.
| Compound Name | N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 19762454 |
| Molecular Formula | C13H13F5N2O2 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)piperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(Oc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H13F5N2O2/c1-19-13(21)20-4-2-6(3-5-20)22-12-10(17)8(15)7(14)9(16)11(12)18/h6H,2-5H2,1H3,(H,19,21) |
| InChIKey | IYSBWROHMMSBQQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|