C22H34N4O — CID 19762600
N'-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl]-N'-methylhexane-1,6-diamine (PubChem CID 19762600) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is N'-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl]-N'-methylhexane-1,6-diamine.
| Compound Name | N'-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl]-N'-methylhexane-1,6-diamine |
|---|---|
| PubChem CID | 19762600 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | N'-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl]-N'-methylhexane-1,6-diamine |
| SMILES | COc1ccc(CN(CCN(C)CCCCCCN)c2ccccn2)cc1 |
| InChI | InChI=1S/C22H34N4O/c1-25(16-8-4-3-6-14-23)17-18-26(22-9-5-7-15-24-22)19-20-10-12-21(27-2)13-11-20/h5,7,9-13,15H,3-4,6,8,14,16-19,23H2,1-2H3 |
| InChIKey | AYEQNAFPDMJGOZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|