C8H6N4O — CID 19762845
1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one (PubChem CID 19762845) has the molecular formula C8H6N4O and a molecular weight of 174.16 g/mol. Its IUPAC name is 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one.
| Compound Name | 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
|---|---|
| PubChem CID | 19762845 |
| Molecular Formula | C8H6N4O |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
| SMILES | O=c1ncn2c3c1cnn3C=CC2 |
| InChI | InChI=1S/C8H6N4O/c13-7-6-4-10-12-3-1-2-11(5-9-7)8(6)12/h1,3-5H,2H2 |
| InChIKey | HGOQXPTZTZPWMD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |