About 5-acetyl-3,6-dimethyl-1H-pyridin-2-one
5-acetyl-3,6-dimethyl-1H-pyridin-2-one (PubChem CID 19762907) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-acetyl-3,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-acetyl-3,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 19762907 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5-acetyl-3,6-dimethyl-1H-pyridin-2-one |
| SMILES | CC(=O)c1cc(C)c(=O)[nH]c1C |
| InChI | InChI=1S/C9H11NO2/c1-5-4-8(7(3)11)6(2)10-9(5)12/h4H,1-3H3,(H,10,12) |
| InChIKey | RKEOAWUVNJMNQH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-acetyl-3,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 5-acetyl-3,6-dimethyl-1H-pyridin-2-one (CID 19762907) is 5-acetyl-3,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 5-acetyl-3,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 5-acetyl-3,6-dimethyl-1H-pyridin-2-one is CC(=O)c1cc(C)c(=O)[nH]c1C.
What is the InChIKey of 5-acetyl-3,6-dimethyl-1H-pyridin-2-one?
The InChIKey is RKEOAWUVNJMNQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-5-4-8(7(3)11)6(2)10-9(5)12/h4H,1-3H3,(H,10,12).
What are the key properties of 5-acetyl-3,6-dimethyl-1H-pyridin-2-one?
5-acetyl-3,6-dimethyl-1H-pyridin-2-one has a molecular weight of 165.19 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 19762907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).