C23H26F2N2S — CID 19763057
2-butyl-5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-1,3,4-thiadiazole (PubChem CID 19763057) has the molecular formula C23H26F2N2S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-butyl-5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-butyl-5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 19763057 |
| Molecular Formula | C23H26F2N2S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-butyl-5-[2,3-difluoro-4-(4-pentylphenyl)phenyl]-1,3,4-thiadiazole |
| SMILES | CCCCCc1ccc(-c2ccc(-c3nnc(CCCC)s3)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H26F2N2S/c1-3-5-7-8-16-10-12-17(13-11-16)18-14-15-19(22(25)21(18)24)23-27-26-20(28-23)9-6-4-2/h10-15H,3-9H2,1-2H3 |
| InChIKey | XCRVRJJBRDXPQQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|