About 2-benzazepin-4-one
2-benzazepin-4-one (PubChem CID 19763352) has the molecular formula C10H7NO
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-benzazepin-4-one.
Molecular Properties
| Compound Name | 2-benzazepin-4-one |
| PubChem CID | 19763352 |
| Molecular Formula | C10H7NO |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-benzazepin-4-one |
| SMILES | O=c1cncc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO/c12-10-5-8-3-1-2-4-9(8)6-11-7-10/h1-7H |
| InChIKey | FRODSPDVVZRMFN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzazepin-4-one?
The IUPAC name of 2-benzazepin-4-one (CID 19763352) is 2-benzazepin-4-one.
What is the SMILES notation for 2-benzazepin-4-one?
The canonical SMILES for 2-benzazepin-4-one is O=c1cncc2ccccc2c1.
What is the InChIKey of 2-benzazepin-4-one?
The InChIKey is FRODSPDVVZRMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO/c12-10-5-8-3-1-2-4-9(8)6-11-7-10/h1-7H.
What are the key properties of 2-benzazepin-4-one?
2-benzazepin-4-one has a molecular weight of 157.17 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzazepin-4-one is sourced from PubChem (CID 19763352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).