C29H58O — CID 19763460
2-tert-butyl-2,3-dimethyl-3-(2,3,3,4,4,5,5,6,6,7,7-undecamethyldecan-2-yl)oxirane (PubChem CID 19763460) has the molecular formula C29H58O and a molecular weight of 422.78 g/mol. Its IUPAC name is 2-tert-butyl-2,3-dimethyl-3-(2,3,3,4,4,5,5,6,6,7,7-undecamethyldecan-2-yl)oxirane.
| Compound Name | 2-tert-butyl-2,3-dimethyl-3-(2,3,3,4,4,5,5,6,6,7,7-undecamethyldecan-2-yl)oxirane |
|---|---|
| PubChem CID | 19763460 |
| Molecular Formula | C29H58O |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 422.45 |
| IUPAC Name | 2-tert-butyl-2,3-dimethyl-3-(2,3,3,4,4,5,5,6,6,7,7-undecamethyldecan-2-yl)oxirane |
| SMILES | CCCC(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C1(C)OC1(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O/c1-19-20-22(5,6)23(7,8)24(9,10)25(11,12)26(13,14)27(15,16)29(18)28(17,30-29)21(2,3)4/h19-20H2,1-18H3 |
| InChIKey | JIKAXBOCAAWEGU-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|