C20H16F3O2P — CID 19764058
2,2,2-trifluoroacetate;triphenylphosphanium (PubChem CID 19764058) has the molecular formula C20H16F3O2P and a molecular weight of 376.31 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;triphenylphosphanium.
| Compound Name | 2,2,2-trifluoroacetate;triphenylphosphanium |
|---|---|
| PubChem CID | 19764058 |
| Molecular Formula | C20H16F3O2P |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2,2,2-trifluoroacetate;triphenylphosphanium |
| SMILES | O=C([O-])C(F)(F)F.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C2HF3O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-2(4,5)1(6)7/h1-15H;(H,6,7) |
| InChIKey | HQAFBEZNAWYCKB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|