C22H28N4O4S — CID 19764567
2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylacetic acid (PubChem CID 19764567) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 19764567 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylacetic acid |
| SMILES | CCCn1c(=O)c2[nH]c(C(C)Cc3ccc(SCC(=O)O)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H28N4O4S/c1-4-10-25-20-18(21(29)26(11-5-2)22(25)30)23-19(24-20)14(3)12-15-6-8-16(9-7-15)31-13-17(27)28/h6-9,14H,4-5,10-13H2,1-3H3,(H,23,24)(H,27,28) |
| InChIKey | GHHRKZXPHPYFGN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |