C8H11NO — CID 19765014
3,4,4a,5-tetrahydro-2H-1,4-benzoxazine (PubChem CID 19765014) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 3,4,4a,5-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 19765014 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-1,4-benzoxazine |
| SMILES | C1=CCC2NCCOC2=C1 |
| InChI | InChI=1S/C8H11NO/c1-2-4-8-7(3-1)9-5-6-10-8/h1-2,4,7,9H,3,5-6H2 |
| InChIKey | OFQGDWQZEWDVGY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |