About ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene
ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene (PubChem CID 19765222) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene.
Molecular Properties
| Compound Name | ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene |
| PubChem CID | 19765222 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene |
| SMILES | CCO.c1c2nnn1-2 |
| InChI | InChI=1S/C2HN3.C2H6O/c1-2-3-4-5(1)2;1-2-3/h1H;3H,2H2,1H3 |
| InChIKey | NKUYQHANYBLOFP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene?
The IUPAC name of ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene (CID 19765222) is ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene.
What is the SMILES notation for ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene?
The canonical SMILES for ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene is CCO.c1c2nnn1-2.
What is the InChIKey of ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene?
The InChIKey is NKUYQHANYBLOFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HN3.C2H6O/c1-2-3-4-5(1)2;1-2-3/h1H;3H,2H2,1H3.
What are the key properties of ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene?
ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene has a molecular weight of 113.12 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1,2,3-triazabicyclo[2.1.0]penta-2,4-diene is sourced from PubChem (CID 19765222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).