C17H15F2N — CID 19765720
3-[2-(4-butylphenyl)ethynyl]-2,6-difluoropyridine (PubChem CID 19765720) has the molecular formula C17H15F2N and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-[2-(4-butylphenyl)ethynyl]-2,6-difluoropyridine.
| Compound Name | 3-[2-(4-butylphenyl)ethynyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 19765720 |
| Molecular Formula | C17H15F2N |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[2-(4-butylphenyl)ethynyl]-2,6-difluoropyridine |
| SMILES | CCCCc1ccc(C#Cc2ccc(F)nc2F)cc1 |
| InChI | InChI=1S/C17H15F2N/c1-2-3-4-13-5-7-14(8-6-13)9-10-15-11-12-16(18)20-17(15)19/h5-8,11-12H,2-4H2,1H3 |
| InChIKey | CWJDCBLLSHUMTA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|