C12H3F21O — CID 19765942
1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane (PubChem CID 19765942) has the molecular formula C12H3F21O and a molecular weight of 562.11 g/mol. Its IUPAC name is 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane.
| Compound Name | 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
|---|---|
| PubChem CID | 19765942 |
| Molecular Formula | C12H3F21O |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.98 |
| IUPAC Name | 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
| SMILES | C=COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F21O/c1-2-34-12(32,33)10(27,28)8(23,24)6(19,20)4(15,16)3(13,14)5(17,18)7(21,22)9(25,26)11(29,30)31/h2H,1H2 |
| InChIKey | YDCFYKVIZYKYHA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|