About 4-sulfonylhepta-1,6-dien-3-ol
4-sulfonylhepta-1,6-dien-3-ol (PubChem CID 19766003) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is 4-sulfonylhepta-1,6-dien-3-ol.
Molecular Properties
| Compound Name | 4-sulfonylhepta-1,6-dien-3-ol |
| PubChem CID | 19766003 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 4-sulfonylhepta-1,6-dien-3-ol |
| SMILES | C=CCC(C(O)C=C)=S(=O)=O |
| InChI | InChI=1S/C7H10O3S/c1-3-5-7(11(9)10)6(8)4-2/h3-4,6,8H,1-2,5H2 |
| InChIKey | CVXIJVKERJUWCK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfonylhepta-1,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfonylhepta-1,6-dien-3-ol?
The IUPAC name of 4-sulfonylhepta-1,6-dien-3-ol (CID 19766003) is 4-sulfonylhepta-1,6-dien-3-ol.
What is the SMILES notation for 4-sulfonylhepta-1,6-dien-3-ol?
The canonical SMILES for 4-sulfonylhepta-1,6-dien-3-ol is C=CCC(C(O)C=C)=S(=O)=O.
What is the InChIKey of 4-sulfonylhepta-1,6-dien-3-ol?
The InChIKey is CVXIJVKERJUWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S/c1-3-5-7(11(9)10)6(8)4-2/h3-4,6,8H,1-2,5H2.
What are the key properties of 4-sulfonylhepta-1,6-dien-3-ol?
4-sulfonylhepta-1,6-dien-3-ol has a molecular weight of 174.22 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfonylhepta-1,6-dien-3-ol is sourced from PubChem (CID 19766003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).