About 2-propan-2-yl-1,4-thiazepine
2-propan-2-yl-1,4-thiazepine (PubChem CID 19766156) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-propan-2-yl-1,4-thiazepine.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,4-thiazepine |
| PubChem CID | 19766156 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2-propan-2-yl-1,4-thiazepine |
| SMILES | CC(C)C1=CN=CC=CS1 |
| InChI | InChI=1S/C8H11NS/c1-7(2)8-6-9-4-3-5-10-8/h3-7H,1-2H3 |
| InChIKey | CRCMLNXTFHNYSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,4-thiazepine?
The IUPAC name of 2-propan-2-yl-1,4-thiazepine (CID 19766156) is 2-propan-2-yl-1,4-thiazepine.
What is the SMILES notation for 2-propan-2-yl-1,4-thiazepine?
The canonical SMILES for 2-propan-2-yl-1,4-thiazepine is CC(C)C1=CN=CC=CS1.
What is the InChIKey of 2-propan-2-yl-1,4-thiazepine?
The InChIKey is CRCMLNXTFHNYSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-7(2)8-6-9-4-3-5-10-8/h3-7H,1-2H3.
What are the key properties of 2-propan-2-yl-1,4-thiazepine?
2-propan-2-yl-1,4-thiazepine has a molecular weight of 153.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,4-thiazepine is sourced from PubChem (CID 19766156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).