6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid

C10H14N2O4 — CID 19766657

IUPAC6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid
SMILESNCCCCC(C(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C10H14N2O4/c11-6-2-1-3-7(10(15)16)12-8(13)4-5-9(12)14/h4-5,7H,1-3,6,11H2,(H,15,16)
InChIKeyVHXWQNPWSUWQSD-UHFFFAOYSA-N
MW226.23 g/mol
LogP-0.51
Rot. Bonds6

About 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid

6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid (PubChem CID 19766657) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid.

Molecular Properties

Compound Name6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid
PubChem CID19766657
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid
SMILESNCCCCC(C(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C10H14N2O4/c11-6-2-1-3-7(10(15)16)12-8(13)4-5-9(12)14/h4-5,7H,1-3,6,11H2,(H,15,16)
InChIKeyVHXWQNPWSUWQSD-UHFFFAOYSA-N
XLogP-0.51
TPSA100.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 5-0.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid?
The IUPAC name of 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid (CID 19766657) is 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid.
What is the SMILES notation for 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid?
The canonical SMILES for 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid is NCCCCC(C(=O)O)N1C(=O)C=CC1=O.
What is the InChIKey of 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid?
The InChIKey is VHXWQNPWSUWQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c11-6-2-1-3-7(10(15)16)12-8(13)4-5-9(12)14/h4-5,7H,1-3,6,11H2,(H,15,16).
What are the key properties of 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid?
6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid has a molecular weight of 226.23 g/mol, XLogP of -0.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(2,5-dioxopyrrol-1-yl)hexanoic acid is sourced from PubChem (CID 19766657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).