About 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene
1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene (PubChem CID 19767204) has the molecular formula C24H24F2O
and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene |
| PubChem CID | 19767204 |
| Molecular Formula | C24H24F2O |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(CCc3ccc(CC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C24H24F2O/c1-3-17-5-7-18(8-6-17)9-10-19-11-13-20(14-12-19)21-15-16-22(27-4-2)24(26)23(21)25/h5-8,11-16H,3-4,9-10H2,1-2H3 |
| InChIKey | GXGQGRBDAAKDSM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene?
The IUPAC name of 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene (CID 19767204) is 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene.
What is the SMILES notation for 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene?
The canonical SMILES for 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene is CCOc1ccc(-c2ccc(CCc3ccc(CC)cc3)cc2)c(F)c1F.
What is the InChIKey of 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene?
The InChIKey is GXGQGRBDAAKDSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F2O/c1-3-17-5-7-18(8-6-17)9-10-19-11-13-20(14-12-19)21-15-16-22(27-4-2)24(26)23(21)25/h5-8,11-16H,3-4,9-10H2,1-2H3.
What are the key properties of 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene?
1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene has a molecular weight of 366.45 g/mol, XLogP of 6.38, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-[4-[2-(4-ethylphenyl)ethyl]phenyl]-2,3-difluorobenzene is sourced from PubChem (CID 19767204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).