C14H22N4O3 — CID 19767330
2-methyl-N-[[6-[(2-methylprop-2-enoylamino)methyl]-2-oxo-1,3-diazinan-4-yl]methyl]prop-2-enamide (PubChem CID 19767330) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-methyl-N-[[6-[(2-methylprop-2-enoylamino)methyl]-2-oxo-1,3-diazinan-4-yl]methyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[[6-[(2-methylprop-2-enoylamino)methyl]-2-oxo-1,3-diazinan-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 19767330 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-methyl-N-[[6-[(2-methylprop-2-enoylamino)methyl]-2-oxo-1,3-diazinan-4-yl]methyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCC1CC(CNC(=O)C(=C)C)NC(=O)N1 |
| InChI | InChI=1S/C14H22N4O3/c1-8(2)12(19)15-6-10-5-11(18-14(21)17-10)7-16-13(20)9(3)4/h10-11H,1,3,5-7H2,2,4H3,(H,15,19)(H,16,20)(H2,17,18,21) |
| InChIKey | RBHYQHDUVOAJSO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|