C10H9Br3N2O2 — CID 19767466
tert-butyl 2,3,5-tribromo-4-cyanopyrrole-1-carboxylate (PubChem CID 19767466) has the molecular formula C10H9Br3N2O2 and a molecular weight of 428.91 g/mol. Its IUPAC name is tert-butyl 2,3,5-tribromo-4-cyanopyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,3,5-tribromo-4-cyanopyrrole-1-carboxylate |
|---|---|
| PubChem CID | 19767466 |
| Molecular Formula | C10H9Br3N2O2 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 425.82 |
| IUPAC Name | tert-butyl 2,3,5-tribromo-4-cyanopyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(Br)c(Br)c(C#N)c1Br |
| InChI | InChI=1S/C10H9Br3N2O2/c1-10(2,3)17-9(16)15-7(12)5(4-14)6(11)8(15)13/h1-3H3 |
| InChIKey | ZNMNBOAIYHOZKH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |