C28H48O7P2 — CID 19767561
4-[2,2-bis(dipropoxyphosphoryl)ethenyl]-2-tert-butyl-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 19767561) has the molecular formula C28H48O7P2 and a molecular weight of 558.63 g/mol. Its IUPAC name is 4-[2,2-bis(dipropoxyphosphoryl)ethenyl]-2-tert-butyl-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-[2,2-bis(dipropoxyphosphoryl)ethenyl]-2-tert-butyl-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 19767561 |
| Molecular Formula | C28H48O7P2 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 4-[2,2-bis(dipropoxyphosphoryl)ethenyl]-2-tert-butyl-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CCCOP(=O)(OCCC)C(=Cc1cc(C(C)(C)C)c(O)c2c1CCCC2)P(=O)(OCCC)OCCC |
| InChI | InChI=1S/C28H48O7P2/c1-8-16-32-36(30,33-17-9-2)26(37(31,34-18-10-3)35-19-11-4)21-22-20-25(28(5,6)7)27(29)24-15-13-12-14-23(22)24/h20-21,29H,8-19H2,1-7H3 |
| InChIKey | USTZMPUIXOWBDK-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|