About 6-fluoro-3,5-dihydroxyhept-6-enoic acid
6-fluoro-3,5-dihydroxyhept-6-enoic acid (PubChem CID 19767663) has the molecular formula C7H11FO4
and a molecular weight of 178.16 g/mol. Its IUPAC name is 6-fluoro-3,5-dihydroxyhept-6-enoic acid.
Molecular Properties
| Compound Name | 6-fluoro-3,5-dihydroxyhept-6-enoic acid |
| PubChem CID | 19767663 |
| Molecular Formula | C7H11FO4 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 6-fluoro-3,5-dihydroxyhept-6-enoic acid |
| SMILES | C=C(F)C(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C7H11FO4/c1-4(8)6(10)2-5(9)3-7(11)12/h5-6,9-10H,1-3H2,(H,11,12) |
| InChIKey | PHIYKOIAGGEELG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3,5-dihydroxyhept-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,5-dihydroxyhept-6-enoic acid?
The IUPAC name of 6-fluoro-3,5-dihydroxyhept-6-enoic acid (CID 19767663) is 6-fluoro-3,5-dihydroxyhept-6-enoic acid.
What is the SMILES notation for 6-fluoro-3,5-dihydroxyhept-6-enoic acid?
The canonical SMILES for 6-fluoro-3,5-dihydroxyhept-6-enoic acid is C=C(F)C(O)CC(O)CC(=O)O.
What is the InChIKey of 6-fluoro-3,5-dihydroxyhept-6-enoic acid?
The InChIKey is PHIYKOIAGGEELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO4/c1-4(8)6(10)2-5(9)3-7(11)12/h5-6,9-10H,1-3H2,(H,11,12).
What are the key properties of 6-fluoro-3,5-dihydroxyhept-6-enoic acid?
6-fluoro-3,5-dihydroxyhept-6-enoic acid has a molecular weight of 178.16 g/mol, XLogP of 0.06, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,5-dihydroxyhept-6-enoic acid is sourced from PubChem (CID 19767663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).