About N-ethoxy-N-methylmethanamine;propan-1-amine
N-ethoxy-N-methylmethanamine;propan-1-amine (PubChem CID 19768049) has the molecular formula C7H20N2O
and a molecular weight of 148.25 g/mol. Its IUPAC name is N-ethoxy-N-methylmethanamine;propan-1-amine.
Molecular Properties
| Compound Name | N-ethoxy-N-methylmethanamine;propan-1-amine |
| PubChem CID | 19768049 |
| Molecular Formula | C7H20N2O |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.16 |
| IUPAC Name | N-ethoxy-N-methylmethanamine;propan-1-amine |
| SMILES | CCCN.CCON(C)C |
| InChI | InChI=1S/C4H11NO.C3H9N/c1-4-6-5(2)3;1-2-3-4/h4H2,1-3H3;2-4H2,1H3 |
| InChIKey | FEWYHBMLLMNJSH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-N-methylmethanamine;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-N-methylmethanamine;propan-1-amine?
The IUPAC name of N-ethoxy-N-methylmethanamine;propan-1-amine (CID 19768049) is N-ethoxy-N-methylmethanamine;propan-1-amine.
What is the SMILES notation for N-ethoxy-N-methylmethanamine;propan-1-amine?
The canonical SMILES for N-ethoxy-N-methylmethanamine;propan-1-amine is CCCN.CCON(C)C.
What is the InChIKey of N-ethoxy-N-methylmethanamine;propan-1-amine?
The InChIKey is FEWYHBMLLMNJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C3H9N/c1-4-6-5(2)3;1-2-3-4/h4H2,1-3H3;2-4H2,1H3.
What are the key properties of N-ethoxy-N-methylmethanamine;propan-1-amine?
N-ethoxy-N-methylmethanamine;propan-1-amine has a molecular weight of 148.25 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-N-methylmethanamine;propan-1-amine is sourced from PubChem (CID 19768049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).