C14H12F20N2 — CID 19768118
3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-3,10-bis(trifluoromethyl)dodecane-1,12-diamine (PubChem CID 19768118) has the molecular formula C14H12F20N2 and a molecular weight of 588.22 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-3,10-bis(trifluoromethyl)dodecane-1,12-diamine.
| Compound Name | 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-3,10-bis(trifluoromethyl)dodecane-1,12-diamine |
|---|---|
| PubChem CID | 19768118 |
| Molecular Formula | C14H12F20N2 |
| Molecular Weight | 588.22 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-3,10-bis(trifluoromethyl)dodecane-1,12-diamine |
| SMILES | NCCC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(CCN)C(F)(F)F |
| InChI | InChI=1S/C14H12F20N2/c15-5(1-3-35,13(29,30)31)7(17,18)9(21,22)11(25,26)12(27,28)10(23,24)8(19,20)6(16,2-4-36)14(32,33)34/h1-4,35-36H2 |
| InChIKey | CIJKEZIXPACBQV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.22 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|