About methanamine;naphthalene
methanamine;naphthalene (PubChem CID 19768161) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is methanamine;naphthalene.
Molecular Properties
| Compound Name | methanamine;naphthalene |
| PubChem CID | 19768161 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | methanamine;naphthalene |
| SMILES | CN.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-2/h1-8H;2H2,1H3 |
| InChIKey | PFIUFAQBXKLCJZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methanamine;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;naphthalene?
The IUPAC name of methanamine;naphthalene (CID 19768161) is methanamine;naphthalene.
What is the SMILES notation for methanamine;naphthalene?
The canonical SMILES for methanamine;naphthalene is CN.c1ccc2ccccc2c1.
What is the InChIKey of methanamine;naphthalene?
The InChIKey is PFIUFAQBXKLCJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-2/h1-8H;2H2,1H3.
What are the key properties of methanamine;naphthalene?
methanamine;naphthalene has a molecular weight of 159.23 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;naphthalene is sourced from PubChem (CID 19768161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).