C41H75N7O2 — CID 19768339
2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 19768339) has the molecular formula C41H75N7O2 and a molecular weight of 698.10 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19768339 |
| Molecular Formula | C41H75N7O2 |
| Molecular Weight | 698.10 g/mol |
| Exact Mass | 697.60 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1ncnc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C41H75N7O2/c1-11-13-25-45(32-27-38(3,4)47(39(5,6)28-32)49-34-21-17-15-18-22-34)36-42-31-43-37(44-36)46(26-14-12-2)33-29-40(7,8)48(41(9,10)30-33)50-35-23-19-16-20-24-35/h31-35H,11-30H2,1-10H3 |
| InChIKey | KQUAROHJUNCTOD-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.10 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |