C45H82N8O3 — CID 19768354
2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 19768354) has the molecular formula C45H82N8O3 and a molecular weight of 783.20 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19768354 |
| Molecular Formula | C45H82N8O3 |
| Molecular Weight | 783.20 g/mol |
| Exact Mass | 782.65 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1nc(N2CCOCC2)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C45H82N8O3/c1-11-13-25-50(35-31-42(3,4)52(43(5,6)32-35)55-37-21-17-15-18-22-37)40-46-39(49-27-29-54-30-28-49)47-41(48-40)51(26-14-12-2)36-33-44(7,8)53(45(9,10)34-36)56-38-23-19-16-20-24-38/h35-38H,11-34H2,1-10H3 |
| InChIKey | XVENADPYYCNSJB-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.20 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |