C42H56N2O6 — CID 19768358
bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzene-1,2-dicarboxylate (PubChem CID 19768358) has the molecular formula C42H56N2O6 and a molecular weight of 684.92 g/mol. Its IUPAC name is bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19768358 |
| Molecular Formula | C42H56N2O6 |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] benzene-1,2-dicarboxylate |
| SMILES | CC(ON1C(C)(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(OC(C)c3ccccc3)C(C)(C)C2)CC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C42H56N2O6/c1-29(31-19-13-11-14-20-31)49-43-39(3,4)25-33(26-40(43,5)6)47-37(45)35-23-17-18-24-36(35)38(46)48-34-27-41(7,8)44(42(9,10)28-34)50-30(2)32-21-15-12-16-22-32/h11-24,29-30,33-34H,25-28H2,1-10H3 |
| InChIKey | NEPWCYNJIXCZEV-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |