C44H68N2O6 — CID 19768362
bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] decanedioate (PubChem CID 19768362) has the molecular formula C44H68N2O6 and a molecular weight of 721.04 g/mol. Its IUPAC name is bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] decanedioate.
| Compound Name | bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] decanedioate |
|---|---|
| PubChem CID | 19768362 |
| Molecular Formula | C44H68N2O6 |
| Molecular Weight | 721.04 g/mol |
| Exact Mass | 720.51 |
| IUPAC Name | bis[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] decanedioate |
| SMILES | CC(ON1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OC(C)c3ccccc3)C(C)(C)C2)CC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C44H68N2O6/c1-33(35-23-17-15-18-24-35)51-45-41(3,4)29-37(30-42(45,5)6)49-39(47)27-21-13-11-12-14-22-28-40(48)50-38-31-43(7,8)46(44(9,10)32-38)52-34(2)36-25-19-16-20-26-36/h15-20,23-26,33-34,37-38H,11-14,21-22,27-32H2,1-10H3 |
| InChIKey | ZXUCLCHPAHRQOW-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.04 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|