C45H84N8O2 — CID 19768378
2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 19768378) has the molecular formula C45H84N8O2 and a molecular weight of 769.22 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19768378 |
| Molecular Formula | C45H84N8O2 |
| Molecular Weight | 769.22 g/mol |
| Exact Mass | 768.67 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CC)CC)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C45H84N8O2/c1-13-17-29-50(35-31-42(5,6)52(43(7,8)32-35)54-37-25-21-19-22-26-37)40-46-39(49(15-3)16-4)47-41(48-40)51(30-18-14-2)36-33-44(9,10)53(45(11,12)34-36)55-38-27-23-20-24-28-38/h35-38H,13-34H2,1-12H3 |
| InChIKey | HLOWDDHAFLZDKB-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.22 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |