About N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride
N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 19768520) has the molecular formula C10H12ClN3O2S
and a molecular weight of 273.74 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride |
| PubChem CID | 19768520 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ncsc1-c1ccco1 |
| InChI | InChI=1S/C10H11N3O2S.ClH/c11-3-4-12-10(14)8-9(16-6-13-8)7-2-1-5-15-7;/h1-2,5-6H,3-4,11H2,(H,12,14);1H |
| InChIKey | NDXBFQJTKWNGIW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride (CID 19768520) is N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride is Cl.NCCNC(=O)c1ncsc1-c1ccco1.
What is the InChIKey of N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride?
The InChIKey is NDXBFQJTKWNGIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S.ClH/c11-3-4-12-10(14)8-9(16-6-13-8)7-2-1-5-15-7;/h1-2,5-6H,3-4,11H2,(H,12,14);1H.
What are the key properties of N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride?
N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride has a molecular weight of 273.74 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-5-(furan-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride is sourced from PubChem (CID 19768520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).