About 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid
2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid (PubChem CID 19768798) has the molecular formula C13H14N4O4
and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid.
Molecular Properties
| Compound Name | 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid |
| PubChem CID | 19768798 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid |
| SMILES | Nc1nc(C(=O)NCCNC(=O)O)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C13H14N4O4/c14-12-17-9(11(18)15-6-7-16-13(19)20)10(21-12)8-4-2-1-3-5-8/h1-5,16H,6-7H2,(H2,14,17)(H,15,18)(H,19,20) |
| InChIKey | VCPXLNQDFPFKLF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid?
The IUPAC name of 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid (CID 19768798) is 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid.
What is the SMILES notation for 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid?
The canonical SMILES for 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid is Nc1nc(C(=O)NCCNC(=O)O)c(-c2ccccc2)o1.
What is the InChIKey of 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid?
The InChIKey is VCPXLNQDFPFKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O4/c14-12-17-9(11(18)15-6-7-16-13(19)20)10(21-12)8-4-2-1-3-5-8/h1-5,16H,6-7H2,(H2,14,17)(H,15,18)(H,19,20).
What are the key properties of 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid?
2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid has a molecular weight of 290.28 g/mol, XLogP of 0.92, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-5-phenyl-1,3-oxazole-4-carbonyl)amino]ethylcarbamic acid is sourced from PubChem (CID 19768798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).