C9H15F5 — CID 19768885
1,1,1,2,2-pentafluoro-4-methyl-3-propan-2-ylpentane (PubChem CID 19768885) has the molecular formula C9H15F5 and a molecular weight of 218.21 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-4-methyl-3-propan-2-ylpentane.
| Compound Name | 1,1,1,2,2-pentafluoro-4-methyl-3-propan-2-ylpentane |
|---|---|
| PubChem CID | 19768885 |
| Molecular Formula | C9H15F5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-4-methyl-3-propan-2-ylpentane |
| SMILES | CC(C)C(C(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F5/c1-5(2)7(6(3)4)8(10,11)9(12,13)14/h5-7H,1-4H3 |
| InChIKey | ZISLMWAAAPWRGU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|