C23H33NO3 — CID 19769721
propyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[(4-methylphenyl)methyl]-4-oxobutanoate (PubChem CID 19769721) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is propyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[(4-methylphenyl)methyl]-4-oxobutanoate.
| Compound Name | propyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[(4-methylphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 19769721 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | propyl 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[(4-methylphenyl)methyl]-4-oxobutanoate |
| SMILES | CCCOC(=O)C(CC(=O)N1CC2CCCCC2C1)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C23H33NO3/c1-3-12-27-23(26)21(13-18-10-8-17(2)9-11-18)14-22(25)24-15-19-6-4-5-7-20(19)16-24/h8-11,19-21H,3-7,12-16H2,1-2H3 |
| InChIKey | CSAARXBRKSDOJP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |