C19H22Cl3NO — CID 19769936
(2E,4E)-3-methyl-N-(2-methylpropyl)-5-[2-(3,4,5-trichlorophenyl)cyclopropyl]penta-2,4-dienamide (PubChem CID 19769936) has the molecular formula C19H22Cl3NO and a molecular weight of 386.75 g/mol. Its IUPAC name is (2E,4E)-3-methyl-N-(2-methylpropyl)-5-[2-(3,4,5-trichlorophenyl)cyclopropyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-3-methyl-N-(2-methylpropyl)-5-[2-(3,4,5-trichlorophenyl)cyclopropyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 19769936 |
| Molecular Formula | C19H22Cl3NO |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (2E,4E)-3-methyl-N-(2-methylpropyl)-5-[2-(3,4,5-trichlorophenyl)cyclopropyl]penta-2,4-dienamide |
| SMILES | CC(/C=C/C1CC1c1cc(Cl)c(Cl)c(Cl)c1)=C\C(=O)NCC(C)C |
| InChI | InChI=1S/C19H22Cl3NO/c1-11(2)10-23-18(24)6-12(3)4-5-13-7-15(13)14-8-16(20)19(22)17(21)9-14/h4-6,8-9,11,13,15H,7,10H2,1-3H3,(H,23,24)/b5-4+,12-6+ |
| InChIKey | PCNXVCYPTOFAOZ-ICLXBRQCSA-N |
| XLogP | 6.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|