C21H27Cl2NO — CID 19769942
(2E,4E)-5-[3-(3,4-dichlorophenyl)-2,2-dimethylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide (PubChem CID 19769942) has the molecular formula C21H27Cl2NO and a molecular weight of 380.36 g/mol. Its IUPAC name is (2E,4E)-5-[3-(3,4-dichlorophenyl)-2,2-dimethylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-[3-(3,4-dichlorophenyl)-2,2-dimethylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 19769942 |
| Molecular Formula | C21H27Cl2NO |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2E,4E)-5-[3-(3,4-dichlorophenyl)-2,2-dimethylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| SMILES | CC(C)C(C)NC(=O)/C=C/C=C/C1C(c2ccc(Cl)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C21H27Cl2NO/c1-13(2)14(3)24-19(25)9-7-6-8-16-20(21(16,4)5)15-10-11-17(22)18(23)12-15/h6-14,16,20H,1-5H3,(H,24,25)/b8-6+,9-7+ |
| InChIKey | MGFWBUYZDKIGQV-CDJQDVQCSA-N |
| XLogP | 6.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|