C24H17F15O5S — CID 19770040
[4-(2-ethoxy-2-phenylacetyl)phenyl] 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctane-1-sulfonate (PubChem CID 19770040) has the molecular formula C24H17F15O5S and a molecular weight of 702.43 g/mol. Its IUPAC name is [4-(2-ethoxy-2-phenylacetyl)phenyl] 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctane-1-sulfonate.
| Compound Name | [4-(2-ethoxy-2-phenylacetyl)phenyl] 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 19770040 |
| Molecular Formula | C24H17F15O5S |
| Molecular Weight | 702.43 g/mol |
| Exact Mass | 702.06 |
| IUPAC Name | [4-(2-ethoxy-2-phenylacetyl)phenyl] 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctane-1-sulfonate |
| SMILES | CCOC(C(=O)c1ccc(OS(=O)(=O)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H17F15O5S/c1-2-43-16(13-6-4-3-5-7-13)15(40)12-8-10-14(11-9-12)44-45(41,42)18(27)20(30,31)22(34,35)24(38,39)23(36,37)21(32,33)19(28,29)17(25)26/h3-11,16-18H,2H2,1H3 |
| InChIKey | MDCHAEJDHAUOCB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.43 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|