About [3,4-bis(aminomethyl)cyclohexyl]methanamine
[3,4-bis(aminomethyl)cyclohexyl]methanamine (PubChem CID 19770057) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is [3,4-bis(aminomethyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [3,4-bis(aminomethyl)cyclohexyl]methanamine |
| PubChem CID | 19770057 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | [3,4-bis(aminomethyl)cyclohexyl]methanamine |
| SMILES | NCC1CCC(CN)C(CN)C1 |
| InChI | InChI=1S/C9H21N3/c10-4-7-1-2-8(5-11)9(3-7)6-12/h7-9H,1-6,10-12H2 |
| InChIKey | ZGPMAGXAVSVWGW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3,4-bis(aminomethyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-bis(aminomethyl)cyclohexyl]methanamine?
The IUPAC name of [3,4-bis(aminomethyl)cyclohexyl]methanamine (CID 19770057) is [3,4-bis(aminomethyl)cyclohexyl]methanamine.
What is the SMILES notation for [3,4-bis(aminomethyl)cyclohexyl]methanamine?
The canonical SMILES for [3,4-bis(aminomethyl)cyclohexyl]methanamine is NCC1CCC(CN)C(CN)C1.
What is the InChIKey of [3,4-bis(aminomethyl)cyclohexyl]methanamine?
The InChIKey is ZGPMAGXAVSVWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c10-4-7-1-2-8(5-11)9(3-7)6-12/h7-9H,1-6,10-12H2.
What are the key properties of [3,4-bis(aminomethyl)cyclohexyl]methanamine?
[3,4-bis(aminomethyl)cyclohexyl]methanamine has a molecular weight of 171.29 g/mol, XLogP of -0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-bis(aminomethyl)cyclohexyl]methanamine is sourced from PubChem (CID 19770057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).