C13H9Cl6N3O2 — CID 19770062
2-(3,5-dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 19770062) has the molecular formula C13H9Cl6N3O2 and a molecular weight of 451.95 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 19770062 |
| Molecular Formula | C13H9Cl6N3O2 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 448.88 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1cc(OC)cc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C13H9Cl6N3O2/c1-23-7-3-6(4-8(5-7)24-2)9-20-10(12(14,15)16)22-11(21-9)13(17,18)19/h3-5H,1-2H3 |
| InChIKey | DMEWHJDCFUPARR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|