C17H27F9Si — CID 19770321
dimethyl-(1,2,2,3,3,4,5,6,6-nonafluorohexyl)-non-8-enylsilane (PubChem CID 19770321) has the molecular formula C17H27F9Si and a molecular weight of 430.47 g/mol. Its IUPAC name is dimethyl-(1,2,2,3,3,4,5,6,6-nonafluorohexyl)-non-8-enylsilane.
| Compound Name | dimethyl-(1,2,2,3,3,4,5,6,6-nonafluorohexyl)-non-8-enylsilane |
|---|---|
| PubChem CID | 19770321 |
| Molecular Formula | C17H27F9Si |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | dimethyl-(1,2,2,3,3,4,5,6,6-nonafluorohexyl)-non-8-enylsilane |
| SMILES | C=CCCCCCCC[Si](C)(C)C(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C17H27F9Si/c1-4-5-6-7-8-9-10-11-27(2,3)15(22)17(25,26)16(23,24)13(19)12(18)14(20)21/h4,12-15H,1,5-11H2,2-3H3 |
| InChIKey | QYOJXARKKWFJQT-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|