About 1-azaspiro[4.4]nonane
1-azaspiro[4.4]nonane (PubChem CID 19770737) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is 1-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 1-azaspiro[4.4]nonane |
| PubChem CID | 19770737 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 1-azaspiro[4.4]nonane |
| SMILES | C1CCC2(C1)CCCN2 |
| InChI | InChI=1S/C8H15N/c1-2-5-8(4-1)6-3-7-9-8/h9H,1-7H2 |
| InChIKey | FJGFHPNQSDXCFC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.4]nonane?
The IUPAC name of 1-azaspiro[4.4]nonane (CID 19770737) is 1-azaspiro[4.4]nonane.
What is the SMILES notation for 1-azaspiro[4.4]nonane?
The canonical SMILES for 1-azaspiro[4.4]nonane is C1CCC2(C1)CCCN2.
What is the InChIKey of 1-azaspiro[4.4]nonane?
The InChIKey is FJGFHPNQSDXCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-2-5-8(4-1)6-3-7-9-8/h9H,1-7H2.
What are the key properties of 1-azaspiro[4.4]nonane?
1-azaspiro[4.4]nonane has a molecular weight of 125.22 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.4]nonane is sourced from PubChem (CID 19770737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).